C12H15BrClFN2 — CID 171182448
1-[(1R)-1-(3-bromo-4-chlorophenyl)-2-fluoroethyl]piperazine (PubChem CID 171182448) has the molecular formula C12H15BrClFN2 and a molecular weight of 321.62 g/mol. Its IUPAC name is 1-[(1R)-1-(3-bromo-4-chlorophenyl)-2-fluoroethyl]piperazine.
| Compound Name | 1-[(1R)-1-(3-bromo-4-chlorophenyl)-2-fluoroethyl]piperazine |
|---|---|
| PubChem CID | 171182448 |
| Molecular Formula | C12H15BrClFN2 |
| Molecular Weight | 321.62 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 1-[(1R)-1-(3-bromo-4-chlorophenyl)-2-fluoroethyl]piperazine |
| SMILES | FC[C@@H](c1ccc(Cl)c(Br)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H15BrClFN2/c13-10-7-9(1-2-11(10)14)12(8-15)17-5-3-16-4-6-17/h1-2,7,12,16H,3-6,8H2/t12-/m0/s1 |
| InChIKey | KHYGXIMVAJJNLH-LBPRGKRZSA-N |
| XLogP | 3.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |