C12H17Cl3F2N2 — CID 171274950
1-[(1R)-1-(3-chloro-4-fluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride (PubChem CID 171274950) has the molecular formula C12H17Cl3F2N2 and a molecular weight of 333.64 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chloro-4-fluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-chloro-4-fluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171274950 |
| Molecular Formula | C12H17Cl3F2N2 |
| Molecular Weight | 333.64 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-[(1R)-1-(3-chloro-4-fluorophenyl)-2-fluoroethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC[C@@H](c1ccc(F)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H15ClF2N2.2ClH/c13-10-7-9(1-2-11(10)15)12(8-14)17-5-3-16-4-6-17;;/h1-2,7,12,16H,3-6,8H2;2*1H/t12-;;/m0../s1 |
| InChIKey | GQENDNOXIHVKRA-LTCKWSDVSA-N |
| XLogP | 3.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |