C13H17Cl2F5N2 — CID 171288465
1-[(1S)-2-fluoro-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride (PubChem CID 171288465) has the molecular formula C13H17Cl2F5N2 and a molecular weight of 367.19 g/mol. Its IUPAC name is 1-[(1S)-2-fluoro-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2-fluoro-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288465 |
| Molecular Formula | C13H17Cl2F5N2 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-[(1S)-2-fluoro-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC[C@H](c1ccc(F)c(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H15F5N2.2ClH/c14-8-12(20-5-3-19-4-6-20)9-1-2-11(15)10(7-9)13(16,17)18;;/h1-2,7,12,19H,3-6,8H2;2*1H/t12-;;/m1../s1 |
| InChIKey | YZLZKNJPTKWUFV-CURYUGHLSA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |