C13H16ClF5N2 — CID 171182619
1-[(1R)-2-fluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride (PubChem CID 171182619) has the molecular formula C13H16ClF5N2 and a molecular weight of 330.73 g/mol. Its IUPAC name is 1-[(1R)-2-fluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-2-fluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171182619 |
| Molecular Formula | C13H16ClF5N2 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-[(1R)-2-fluoro-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]piperazine;hydrochloride |
| SMILES | Cl.FC[C@@H](c1ccc(C(F)(F)F)c(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H15F5N2.ClH/c14-8-12(20-5-3-19-4-6-20)9-1-2-10(11(15)7-9)13(16,17)18;/h1-2,7,12,19H,3-6,8H2;1H/t12-;/m0./s1 |
| InChIKey | HEOWQNMBJBGQCK-YDALLXLXSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |