C16H25ClN2O — CID 171281094
1-[(1S)-1-(4-chloro-3-methoxyphenyl)-3-methylbutyl]piperazine (PubChem CID 171281094) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chloro-3-methoxyphenyl)-3-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-(4-chloro-3-methoxyphenyl)-3-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171281094 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-[(1S)-1-(4-chloro-3-methoxyphenyl)-3-methylbutyl]piperazine |
| SMILES | COc1cc([C@H](CC(C)C)N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C16H25ClN2O/c1-12(2)10-15(19-8-6-18-7-9-19)13-4-5-14(17)16(11-13)20-3/h4-5,11-12,15,18H,6-10H2,1-3H3/t15-/m0/s1 |
| InChIKey | SAWKSRGDHGDDOG-HNNXBMFYSA-N |
| XLogP | 3.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |