C18H32Cl2N2 — CID 171286892
1-[(1R)-3-methyl-1-(4-propan-2-ylphenyl)butyl]piperazine;dihydrochloride (PubChem CID 171286892) has the molecular formula C18H32Cl2N2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-[(1R)-3-methyl-1-(4-propan-2-ylphenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-3-methyl-1-(4-propan-2-ylphenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171286892 |
| Molecular Formula | C18H32Cl2N2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[(1R)-3-methyl-1-(4-propan-2-ylphenyl)butyl]piperazine;dihydrochloride |
| SMILES | CC(C)C[C@H](c1ccc(C(C)C)cc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H30N2.2ClH/c1-14(2)13-18(20-11-9-19-10-12-20)17-7-5-16(6-8-17)15(3)4;;/h5-8,14-15,18-19H,9-13H2,1-4H3;2*1H/t18-;;/m1../s1 |
| InChIKey | ZSIORWAVSLLGOW-JPKZNVRTSA-N |
| XLogP | 4.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |