C18H32N2OSi — CID 171291668
trimethyl-[4-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenoxy]silane (PubChem CID 171291668) has the molecular formula C18H32N2OSi and a molecular weight of 320.55 g/mol. Its IUPAC name is trimethyl-[4-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenoxy]silane.
| Compound Name | trimethyl-[4-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenoxy]silane |
|---|---|
| PubChem CID | 171291668 |
| Molecular Formula | C18H32N2OSi |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | trimethyl-[4-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenoxy]silane |
| SMILES | CC(C)C[C@H](c1ccc(O[Si](C)(C)C)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H32N2OSi/c1-15(2)14-18(20-12-10-19-11-13-20)16-6-8-17(9-7-16)21-22(3,4)5/h6-9,15,18-19H,10-14H2,1-5H3/t18-/m1/s1 |
| InChIKey | HMRRQILRRDTBBO-GOSISDBHSA-N |
| XLogP | 3.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|