C17H25ClF4N2O — CID 171171217
1-[(1R)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine;hydrochloride (PubChem CID 171171217) has the molecular formula C17H25ClF4N2O and a molecular weight of 384.85 g/mol. Its IUPAC name is 1-[(1R)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171171217 |
| Molecular Formula | C17H25ClF4N2O |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[(1R)-3-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine;hydrochloride |
| SMILES | CC(C)C[C@H](c1ccc(OC(F)(F)C(F)F)cc1)N1CCNCC1.Cl |
| InChI | InChI=1S/C17H24F4N2O.ClH/c1-12(2)11-15(23-9-7-22-8-10-23)13-3-5-14(6-4-13)24-17(20,21)16(18)19;/h3-6,12,15-16,22H,7-11H2,1-2H3;1H/t15-;/m1./s1 |
| InChIKey | IWEGWHRCAZJLQQ-XFULWGLBSA-N |
| XLogP | 4.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|