C15H21ClF4N2O2 — CID 171173823
(3R)-3-piperazin-1-yl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride (PubChem CID 171173823) has the molecular formula C15H21ClF4N2O2 and a molecular weight of 372.79 g/mol. Its IUPAC name is (3R)-3-piperazin-1-yl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride.
| Compound Name | (3R)-3-piperazin-1-yl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171173823 |
| Molecular Formula | C15H21ClF4N2O2 |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (3R)-3-piperazin-1-yl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-ol;hydrochloride |
| SMILES | Cl.OCC[C@H](c1ccc(OC(F)(F)C(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C15H20F4N2O2.ClH/c16-14(17)15(18,19)23-12-3-1-11(2-4-12)13(5-10-22)21-8-6-20-7-9-21;/h1-4,13-14,20,22H,5-10H2;1H/t13-;/m1./s1 |
| InChIKey | QTSNOQNZCJICGA-BTQNPOSSSA-N |
| XLogP | 2.67 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|