C15H18ClF7N2O — CID 171165894
1-[(1S)-3,3,3-trifluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;hydrochloride (PubChem CID 171165894) has the molecular formula C15H18ClF7N2O and a molecular weight of 410.76 g/mol. Its IUPAC name is 1-[(1S)-3,3,3-trifluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-3,3,3-trifluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171165894 |
| Molecular Formula | C15H18ClF7N2O |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[(1S)-3,3,3-trifluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)C(F)(F)Oc1ccc([C@H](CC(F)(F)F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H17F7N2O.ClH/c16-13(17)15(21,22)25-11-3-1-10(2-4-11)12(9-14(18,19)20)24-7-5-23-6-8-24;/h1-4,12-13,23H,5-9H2;1H/t12-;/m0./s1 |
| InChIKey | WQWBYMGHDFXCOA-YDALLXLXSA-N |
| XLogP | 4.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|