C17H24F4N2O — CID 171304664
1-[(1R)-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine (PubChem CID 171304664) has the molecular formula C17H24F4N2O and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-[(1R)-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine.
| Compound Name | 1-[(1R)-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine |
|---|---|
| PubChem CID | 171304664 |
| Molecular Formula | C17H24F4N2O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[(1R)-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]piperazine |
| SMILES | CCC(C)[C@H](c1ccc(OC(F)(F)C(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C17H24F4N2O/c1-3-12(2)15(23-10-8-22-9-11-23)13-4-6-14(7-5-13)24-17(20,21)16(18)19/h4-7,12,15-16,22H,3,8-11H2,1-2H3/t12?,15-/m1/s1 |
| InChIKey | GEXADRIGKHVCAE-WPZCJLIBSA-N |
| XLogP | 3.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|