C16H20Cl2F6N2 — CID 171285468
1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;dihydrochloride (PubChem CID 171285468) has the molecular formula C16H20Cl2F6N2 and a molecular weight of 425.24 g/mol. Its IUPAC name is 1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171285468 |
| Molecular Formula | C16H20Cl2F6N2 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=CC[C@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H18F6N2.2ClH/c1-2-3-14(24-6-4-23-5-7-24)11-8-12(15(17,18)19)10-13(9-11)16(20,21)22;;/h2,8-10,14,23H,1,3-7H2;2*1H/t14-;;/m1../s1 |
| InChIKey | NBSNNYYKEMQGLF-FMOMHUKBSA-N |
| XLogP | 5.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|