C13H15ClF4N2 — CID 171182810
1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine (PubChem CID 171182810) has the molecular formula C13H15ClF4N2 and a molecular weight of 310.72 g/mol. Its IUPAC name is 1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine.
| Compound Name | 1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine |
|---|---|
| PubChem CID | 171182810 |
| Molecular Formula | C13H15ClF4N2 |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]-2-fluoroethyl]piperazine |
| SMILES | FC[C@@H](c1cc(Cl)cc(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H15ClF4N2/c14-11-6-9(5-10(7-11)13(16,17)18)12(8-15)20-3-1-19-2-4-20/h5-7,12,19H,1-4,8H2/t12-/m0/s1 |
| InChIKey | TWCLAFPVSUXKPU-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |