C14H19Cl2F3N2 — CID 171172900
1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride (PubChem CID 171172900) has the molecular formula C14H19Cl2F3N2 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172900 |
| Molecular Formula | C14H19Cl2F3N2 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-[(1R)-1-[3-chloro-5-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride |
| SMILES | CC[C@H](c1cc(Cl)cc(C(F)(F)F)c1)N1CCNCC1.Cl |
| InChI | InChI=1S/C14H18ClF3N2.ClH/c1-2-13(20-5-3-19-4-6-20)10-7-11(14(16,17)18)9-12(15)8-10;/h7-9,13,19H,2-6H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | RAJXZINVRAYVAJ-BTQNPOSSSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |