C16H15Cl2F3N2S — CID 171181302
1-[(R)-(5-chlorothiophen-2-yl)-[3-chloro-5-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 171181302) has the molecular formula C16H15Cl2F3N2S and a molecular weight of 395.28 g/mol. Its IUPAC name is 1-[(R)-(5-chlorothiophen-2-yl)-[3-chloro-5-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-(5-chlorothiophen-2-yl)-[3-chloro-5-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171181302 |
| Molecular Formula | C16H15Cl2F3N2S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 1-[(R)-(5-chlorothiophen-2-yl)-[3-chloro-5-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cc(Cl)cc([C@H](c2ccc(Cl)s2)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H15Cl2F3N2S/c17-12-8-10(7-11(9-12)16(19,20)21)15(13-1-2-14(18)24-13)23-5-3-22-4-6-23/h1-2,7-9,15,22H,3-6H2/t15-/m1/s1 |
| InChIKey | IRNJMNVFRACKLZ-OAHLLOKOSA-N |
| XLogP | 5.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |