C16H15ClF4N2S — CID 171180368
1-[(R)-(5-chlorothiophen-2-yl)-[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 171180368) has the molecular formula C16H15ClF4N2S and a molecular weight of 378.82 g/mol. Its IUPAC name is 1-[(R)-(5-chlorothiophen-2-yl)-[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-(5-chlorothiophen-2-yl)-[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171180368 |
| Molecular Formula | C16H15ClF4N2S |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1-[(R)-(5-chlorothiophen-2-yl)-[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | Fc1ccc([C@H](c2ccc(Cl)s2)N2CCNCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15ClF4N2S/c17-14-4-3-13(24-14)15(23-7-5-22-6-8-23)11-2-1-10(18)9-12(11)16(19,20)21/h1-4,9,15,22H,5-8H2/t15-/m1/s1 |
| InChIKey | CBRUYFYPSRETQG-OAHLLOKOSA-N |
| XLogP | 4.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |