C15H16BrCl2FN2S — CID 171175701
1-[(S)-(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride (PubChem CID 171175701) has the molecular formula C15H16BrCl2FN2S and a molecular weight of 426.18 g/mol. Its IUPAC name is 1-[(S)-(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171175701 |
| Molecular Formula | C15H16BrCl2FN2S |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | 1-[(S)-(2-bromo-5-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(Br)c([C@@H](c2ccc(Cl)s2)N2CCNCC2)c1 |
| InChI | InChI=1S/C15H15BrClFN2S.ClH/c16-12-2-1-10(18)9-11(12)15(13-3-4-14(17)21-13)20-7-5-19-6-8-20;/h1-4,9,15,19H,5-8H2;1H/t15-;/m0./s1 |
| InChIKey | WQNPDGYWHYNXSQ-RSAXXLAASA-N |
| XLogP | 4.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |