C15H15BrClFN2S — CID 171179154
1-[(R)-(3-bromo-2-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine (PubChem CID 171179154) has the molecular formula C15H15BrClFN2S and a molecular weight of 389.72 g/mol. Its IUPAC name is 1-[(R)-(3-bromo-2-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(3-bromo-2-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171179154 |
| Molecular Formula | C15H15BrClFN2S |
| Molecular Weight | 389.72 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 1-[(R)-(3-bromo-2-fluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine |
| SMILES | Fc1c(Br)cccc1[C@H](c1ccc(Cl)s1)N1CCNCC1 |
| InChI | InChI=1S/C15H15BrClFN2S/c16-11-3-1-2-10(14(11)18)15(12-4-5-13(17)21-12)20-8-6-19-7-9-20/h1-5,15,19H,6-9H2/t15-/m1/s1 |
| InChIKey | LRLGCANXQSEMHI-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |