C16H18ClFN2OS — CID 171179683
1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-3-methoxyphenyl)methyl]piperazine (PubChem CID 171179683) has the molecular formula C16H18ClFN2OS and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-3-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-3-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171179683 |
| Molecular Formula | C16H18ClFN2OS |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-3-methoxyphenyl)methyl]piperazine |
| SMILES | COc1cccc([C@H](c2ccc(Cl)s2)N2CCNCC2)c1F |
| InChI | InChI=1S/C16H18ClFN2OS/c1-21-12-4-2-3-11(15(12)18)16(13-5-6-14(17)22-13)20-9-7-19-8-10-20/h2-6,16,19H,7-10H2,1H3/t16-/m1/s1 |
| InChIKey | PWHQXKKLIZOWSK-MRXNPFEDSA-N |
| XLogP | 3.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |