C16H18ClFN2S — CID 171178914
1-[(R)-(5-chlorothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]piperazine (PubChem CID 171178914) has the molecular formula C16H18ClFN2S and a molecular weight of 324.85 g/mol. Its IUPAC name is 1-[(R)-(5-chlorothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]piperazine.
| Compound Name | 1-[(R)-(5-chlorothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 171178914 |
| Molecular Formula | C16H18ClFN2S |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-[(R)-(5-chlorothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]piperazine |
| SMILES | Cc1cc(F)ccc1[C@H](c1ccc(Cl)s1)N1CCNCC1 |
| InChI | InChI=1S/C16H18ClFN2S/c1-11-10-12(18)2-3-13(11)16(14-4-5-15(17)21-14)20-8-6-19-7-9-20/h2-5,10,16,19H,6-9H2,1H3/t16-/m1/s1 |
| InChIKey | MXXBOOTWBNWBNU-MRXNPFEDSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |