C16H19Cl2FN2S — CID 171178939
1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-4-methylphenyl)methyl]piperazine;hydrochloride (PubChem CID 171178939) has the molecular formula C16H19Cl2FN2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-4-methylphenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-4-methylphenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171178939 |
| Molecular Formula | C16H19Cl2FN2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1-[(R)-(5-chlorothiophen-2-yl)-(2-fluoro-4-methylphenyl)methyl]piperazine;hydrochloride |
| SMILES | Cc1ccc([C@H](c2ccc(Cl)s2)N2CCNCC2)c(F)c1.Cl |
| InChI | InChI=1S/C16H18ClFN2S.ClH/c1-11-2-3-12(13(18)10-11)16(14-4-5-15(17)21-14)20-8-6-19-7-9-20;/h2-5,10,16,19H,6-9H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | ISXQWFNLJLIMPF-PKLMIRHRSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |