C17H18ClF3N2OS — CID 171180166
1-[(R)-(5-chlorothiophen-2-yl)-[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 171180166) has the molecular formula C17H18ClF3N2OS and a molecular weight of 390.86 g/mol. Its IUPAC name is 1-[(R)-(5-chlorothiophen-2-yl)-[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-(5-chlorothiophen-2-yl)-[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171180166 |
| Molecular Formula | C17H18ClF3N2OS |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 1-[(R)-(5-chlorothiophen-2-yl)-[4-methoxy-2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | COc1ccc([C@H](c2ccc(Cl)s2)N2CCNCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18ClF3N2OS/c1-24-11-2-3-12(13(10-11)17(19,20)21)16(14-4-5-15(18)25-14)23-8-6-22-7-9-23/h2-5,10,16,22H,6-9H2,1H3/t16-/m1/s1 |
| InChIKey | MPDYGRRQGTVPES-MRXNPFEDSA-N |
| XLogP | 4.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |