C17H16F6N2S — CID 171174966
1-[(S)-[3,5-bis(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine (PubChem CID 171174966) has the molecular formula C17H16F6N2S and a molecular weight of 394.38 g/mol. Its IUPAC name is 1-[(S)-[3,5-bis(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-[(S)-[3,5-bis(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171174966 |
| Molecular Formula | C17H16F6N2S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-[(S)-[3,5-bis(trifluoromethyl)phenyl]-thiophen-2-ylmethyl]piperazine |
| SMILES | FC(F)(F)c1cc([C@@H](c2cccs2)N2CCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F6N2S/c18-16(19,20)12-8-11(9-13(10-12)17(21,22)23)15(14-2-1-7-26-14)25-5-3-24-4-6-25/h1-2,7-10,15,24H,3-6H2/t15-/m0/s1 |
| InChIKey | RWLKBEVNWORRML-HNNXBMFYSA-N |
| XLogP | 4.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |