C15H20Cl2N2O2S — CID 171273859
5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,3-diol;dihydrochloride (PubChem CID 171273859) has the molecular formula C15H20Cl2N2O2S and a molecular weight of 363.31 g/mol. Its IUPAC name is 5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,3-diol;dihydrochloride.
| Compound Name | 5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,3-diol;dihydrochloride |
|---|---|
| PubChem CID | 171273859 |
| Molecular Formula | C15H20Cl2N2O2S |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzene-1,3-diol;dihydrochloride |
| SMILES | Cl.Cl.Oc1cc(O)cc([C@H](c2cccs2)N2CCNCC2)c1 |
| InChI | InChI=1S/C15H18N2O2S.2ClH/c18-12-8-11(9-13(19)10-12)15(14-2-1-7-20-14)17-5-3-16-4-6-17;;/h1-2,7-10,15-16,18-19H,3-6H2;2*1H/t15-;;/m1../s1 |
| InChIKey | HJWNXWNSAFYPCT-QCUBGVIVSA-N |
| XLogP | 3.00 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |