C15H16Br2N2OS — CID 171286564
2,6-dibromo-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol (PubChem CID 171286564) has the molecular formula C15H16Br2N2OS and a molecular weight of 432.18 g/mol. Its IUPAC name is 2,6-dibromo-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 171286564 |
| Molecular Formula | C15H16Br2N2OS |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 2,6-dibromo-4-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol |
| SMILES | Oc1c(Br)cc([C@@H](c2cccs2)N2CCNCC2)cc1Br |
| InChI | InChI=1S/C15H16Br2N2OS/c16-11-8-10(9-12(17)15(11)20)14(13-2-1-7-21-13)19-5-3-18-4-6-19/h1-2,7-9,14,18,20H,3-6H2/t14-/m0/s1 |
| InChIKey | HQFHNBBQMYDCMR-AWEZNQCLSA-N |
| XLogP | 3.97 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |