C15H18BrCl2FN2S — CID 171289451
1-[(S)-(3-bromo-5-fluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171289451) has the molecular formula C15H18BrCl2FN2S and a molecular weight of 428.20 g/mol. Its IUPAC name is 1-[(S)-(3-bromo-5-fluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(3-bromo-5-fluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171289451 |
| Molecular Formula | C15H18BrCl2FN2S |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | 1-[(S)-(3-bromo-5-fluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1cc(Br)cc([C@@H](c2cccs2)N2CCNCC2)c1 |
| InChI | InChI=1S/C15H16BrFN2S.2ClH/c16-12-8-11(9-13(17)10-12)15(14-2-1-7-20-14)19-5-3-18-4-6-19;;/h1-2,7-10,15,18H,3-6H2;2*1H/t15-;;/m0../s1 |
| InChIKey | MADLYDNHLSIQAN-CKUXDGONSA-N |
| XLogP | 4.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |