C15H17BrCl2F2N2S — CID 171277701
1-[(R)-(3-bromo-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171277701) has the molecular formula C15H17BrCl2F2N2S and a molecular weight of 446.19 g/mol. Its IUPAC name is 1-[(R)-(3-bromo-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(3-bromo-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277701 |
| Molecular Formula | C15H17BrCl2F2N2S |
| Molecular Weight | 446.19 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | 1-[(R)-(3-bromo-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(Br)c(F)c1[C@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C15H15BrF2N2S.2ClH/c16-10-3-4-11(17)13(14(10)18)15(12-2-1-9-21-12)20-7-5-19-6-8-20;;/h1-4,9,15,19H,5-8H2;2*1H/t15-;;/m0../s1 |
| InChIKey | JUIBFSXLNYKZGZ-CKUXDGONSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|