C15H17Cl2F3N2S — CID 171290300
1-[(S)-thiophen-2-yl-(2,3,6-trifluorophenyl)methyl]piperazine;dihydrochloride (PubChem CID 171290300) has the molecular formula C15H17Cl2F3N2S and a molecular weight of 385.28 g/mol. Its IUPAC name is 1-[(S)-thiophen-2-yl-(2,3,6-trifluorophenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-thiophen-2-yl-(2,3,6-trifluorophenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290300 |
| Molecular Formula | C15H17Cl2F3N2S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 1-[(S)-thiophen-2-yl-(2,3,6-trifluorophenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(F)c([C@@H](c2cccs2)N2CCNCC2)c1F |
| InChI | InChI=1S/C15H15F3N2S.2ClH/c16-10-3-4-11(17)14(18)13(10)15(12-2-1-9-21-12)20-7-5-19-6-8-20;;/h1-4,9,15,19H,5-8H2;2*1H/t15-;;/m1../s1 |
| InChIKey | NLYIKPXYEASGEG-QCUBGVIVSA-N |
| XLogP | 4.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|