C15H15ClF2N2S — CID 171180326
1-[(R)-(3-chloro-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine (PubChem CID 171180326) has the molecular formula C15H15ClF2N2S and a molecular weight of 328.81 g/mol. Its IUPAC name is 1-[(R)-(3-chloro-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine.
| Compound Name | 1-[(R)-(3-chloro-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171180326 |
| Molecular Formula | C15H15ClF2N2S |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-[(R)-(3-chloro-2,6-difluorophenyl)-thiophen-2-ylmethyl]piperazine |
| SMILES | Fc1ccc(Cl)c(F)c1[C@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C15H15ClF2N2S/c16-10-3-4-11(17)13(14(10)18)15(12-2-1-9-21-12)20-7-5-19-6-8-20/h1-4,9,15,19H,5-8H2/t15-/m0/s1 |
| InChIKey | KDJGQVFOBKIOAG-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|