C13H17BrCl2N2S2 — CID 171281047
1-[(S)-(3-bromothiophen-2-yl)-thiophen-2-ylmethyl]piperazine;dihydrochloride (PubChem CID 171281047) has the molecular formula C13H17BrCl2N2S2 and a molecular weight of 416.24 g/mol. Its IUPAC name is 1-[(S)-(3-bromothiophen-2-yl)-thiophen-2-ylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(3-bromothiophen-2-yl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281047 |
| Molecular Formula | C13H17BrCl2N2S2 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 1-[(S)-(3-bromothiophen-2-yl)-thiophen-2-ylmethyl]piperazine;dihydrochloride |
| SMILES | Brc1ccsc1[C@H](c1cccs1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H15BrN2S2.2ClH/c14-10-3-9-18-13(10)12(11-2-1-8-17-11)16-6-4-15-5-7-16;;/h1-3,8-9,12,15H,4-7H2;2*1H/t12-;;/m0../s1 |
| InChIKey | MVICOWGJQZFJPD-LTCKWSDVSA-N |
| XLogP | 4.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |