C10H13BrF2N2S — CID 131424917
1-[(1R)-1-(3-bromothiophen-2-yl)-2,2-difluoroethyl]piperazine (PubChem CID 131424917) has the molecular formula C10H13BrF2N2S and a molecular weight of 311.19 g/mol. Its IUPAC name is 1-[(1R)-1-(3-bromothiophen-2-yl)-2,2-difluoroethyl]piperazine.
| Compound Name | 1-[(1R)-1-(3-bromothiophen-2-yl)-2,2-difluoroethyl]piperazine |
|---|---|
| PubChem CID | 131424917 |
| Molecular Formula | C10H13BrF2N2S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 1-[(1R)-1-(3-bromothiophen-2-yl)-2,2-difluoroethyl]piperazine |
| SMILES | FC(F)[C@H](c1sccc1Br)N1CCNCC1 |
| InChI | InChI=1S/C10H13BrF2N2S/c11-7-1-6-16-9(7)8(10(12)13)15-4-2-14-3-5-15/h1,6,8,10,14H,2-5H2/t8-/m0/s1 |
| InChIKey | XRJKACWMDRRTIJ-QMMMGPOBSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |