C16H16BrF3N2OS — CID 171281050
1-[(S)-(3-bromothiophen-2-yl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171281050) has the molecular formula C16H16BrF3N2OS and a molecular weight of 421.28 g/mol. Its IUPAC name is 1-[(S)-(3-bromothiophen-2-yl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-(3-bromothiophen-2-yl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171281050 |
| Molecular Formula | C16H16BrF3N2OS |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 1-[(S)-(3-bromothiophen-2-yl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)Oc1ccc([C@@H](c2sccc2Br)N2CCNCC2)cc1 |
| InChI | InChI=1S/C16H16BrF3N2OS/c17-13-5-10-24-15(13)14(22-8-6-21-7-9-22)11-1-3-12(4-2-11)23-16(18,19)20/h1-5,10,14,21H,6-9H2/t14-/m0/s1 |
| InChIKey | XHXICGFHUZUCDC-AWEZNQCLSA-N |
| XLogP | 4.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |