C18H17Br2F3N2O2 — CID 171272161
2,4-dibromo-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol (PubChem CID 171272161) has the molecular formula C18H17Br2F3N2O2 and a molecular weight of 510.15 g/mol. Its IUPAC name is 2,4-dibromo-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 171272161 |
| Molecular Formula | C18H17Br2F3N2O2 |
| Molecular Weight | 510.15 g/mol |
| Exact Mass | 507.96 |
| IUPAC Name | 2,4-dibromo-6-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1[C@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H17Br2F3N2O2/c19-12-9-14(17(26)15(20)10-12)16(25-7-5-24-6-8-25)11-1-3-13(4-2-11)27-18(21,22)23/h1-4,9-10,16,24,26H,5-8H2/t16-/m0/s1 |
| InChIKey | ACRLDWWISWCANS-INIZCTEOSA-N |
| XLogP | 4.81 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.15 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|