C18H19F3N2O3 — CID 171287430
2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,4-diol (PubChem CID 171287430) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,4-diol.
| Compound Name | 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 171287430 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H19F3N2O3/c19-18(20,21)26-14-4-1-12(2-5-14)17(23-9-7-22-8-10-23)15-11-13(24)3-6-16(15)25/h1-6,11,17,22,24-25H,7-10H2/t17-/m1/s1 |
| InChIKey | CJRQXSPWHAKJFQ-QGZVFWFLSA-N |
| XLogP | 2.99 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|