C19H18F6N2O2S — CID 171301860
2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethylsulfanyl)phenol (PubChem CID 171301860) has the molecular formula C19H18F6N2O2S and a molecular weight of 452.42 g/mol. Its IUPAC name is 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethylsulfanyl)phenol.
| Compound Name | 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethylsulfanyl)phenol |
|---|---|
| PubChem CID | 171301860 |
| Molecular Formula | C19H18F6N2O2S |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]-4-(trifluoromethylsulfanyl)phenol |
| SMILES | Oc1ccc(SC(F)(F)F)cc1[C@@H](c1ccc(OC(F)(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C19H18F6N2O2S/c20-18(21,22)29-13-3-1-12(2-4-13)17(27-9-7-26-8-10-27)15-11-14(5-6-16(15)28)30-19(23,24)25/h1-6,11,17,26,28H,7-10H2/t17-/m1/s1 |
| InChIKey | DRVUUOJJUNUSSC-QGZVFWFLSA-N |
| XLogP | 4.90 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|