C18H21Cl2F3N2O3 — CID 171274700
3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,2-diol;dihydrochloride (PubChem CID 171274700) has the molecular formula C18H21Cl2F3N2O3 and a molecular weight of 441.28 g/mol. Its IUPAC name is 3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,2-diol;dihydrochloride.
| Compound Name | 3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 171274700 |
| Molecular Formula | C18H21Cl2F3N2O3 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzene-1,2-diol;dihydrochloride |
| SMILES | Cl.Cl.Oc1cccc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c1O |
| InChI | InChI=1S/C18H19F3N2O3.2ClH/c19-18(20,21)26-13-6-4-12(5-7-13)16(23-10-8-22-9-11-23)14-2-1-3-15(24)17(14)25;;/h1-7,16,22,24-25H,8-11H2;2*1H/t16-;;/m0../s1 |
| InChIKey | HMVAKVNZWVQFDN-SQKCAUCHSA-N |
| XLogP | 3.83 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|