C19H18F3N3O2 — CID 171299620
2-hydroxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile (PubChem CID 171299620) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-hydroxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile.
| Compound Name | 2-hydroxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile |
|---|---|
| PubChem CID | 171299620 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-hydroxy-3-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]benzonitrile |
| SMILES | N#Cc1cccc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c1O |
| InChI | InChI=1S/C19H18F3N3O2/c20-19(21,22)27-15-6-4-13(5-7-15)17(25-10-8-24-9-11-25)16-3-1-2-14(12-23)18(16)26/h1-7,17,24,26H,8-11H2/t17-/m0/s1 |
| InChIKey | UQABWFBQCJUZKM-KRWDZBQOSA-N |
| XLogP | 3.16 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|