C19H21F3N2O3 — CID 171294269
2-methoxy-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol (PubChem CID 171294269) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-methoxy-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol.
| Compound Name | 2-methoxy-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 171294269 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-methoxy-6-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
| SMILES | COc1cccc([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)c1O |
| InChI | InChI=1S/C19H21F3N2O3/c1-26-16-4-2-3-15(18(16)25)17(24-11-9-23-10-12-24)13-5-7-14(8-6-13)27-19(20,21)22/h2-8,17,23,25H,9-12H2,1H3/t17-/m1/s1 |
| InChIKey | CKGJBYWHQTYFRN-QGZVFWFLSA-N |
| XLogP | 3.29 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|