C19H18F6N2O2 — CID 18348182
1-[bis[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 18348182) has the molecular formula C19H18F6N2O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 1-[bis[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[bis[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 18348182 |
| Molecular Formula | C19H18F6N2O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-[bis[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)Oc1ccc(C(c2ccc(OC(F)(F)F)cc2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C19H18F6N2O2/c20-18(21,22)28-15-5-1-13(2-6-15)17(27-11-9-26-10-12-27)14-3-7-16(8-4-14)29-19(23,24)25/h1-8,17,26H,9-12H2 |
| InChIKey | JRVBIUAGANMTKE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |