C16H18ClF3N2OS — CID 171180039
1-[(R)-thiophen-3-yl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171180039) has the molecular formula C16H18ClF3N2OS and a molecular weight of 378.85 g/mol. Its IUPAC name is 1-[(R)-thiophen-3-yl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-thiophen-3-yl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171180039 |
| Molecular Formula | C16H18ClF3N2OS |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-[(R)-thiophen-3-yl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)Oc1ccc([C@H](c2ccsc2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C16H17F3N2OS.ClH/c17-16(18,19)22-14-3-1-12(2-4-14)15(13-5-10-23-11-13)21-8-6-20-7-9-21;/h1-5,10-11,15,20H,6-9H2;1H/t15-;/m1./s1 |
| InChIKey | FHZGYLUXRKQGMO-XFULWGLBSA-N |
| XLogP | 4.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |