C19H21F3N2OS — CID 171281961
1-[(S)-(4-methylsulfanylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171281961) has the molecular formula C19H21F3N2OS and a molecular weight of 382.45 g/mol. Its IUPAC name is 1-[(S)-(4-methylsulfanylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-(4-methylsulfanylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171281961 |
| Molecular Formula | C19H21F3N2OS |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-[(S)-(4-methylsulfanylphenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | CSc1ccc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C19H21F3N2OS/c1-26-17-8-4-15(5-9-17)18(24-12-10-23-11-13-24)14-2-6-16(7-3-14)25-19(20,21)22/h2-9,18,23H,10-13H2,1H3/t18-/m0/s1 |
| InChIKey | IXXQKAJGDZPXJS-SFHVURJKSA-N |
| XLogP | 4.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |