C18H17F3I2N2O2 — CID 171296503
2,6-diiodo-4-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol (PubChem CID 171296503) has the molecular formula C18H17F3I2N2O2 and a molecular weight of 604.15 g/mol. Its IUPAC name is 2,6-diiodo-4-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol.
| Compound Name | 2,6-diiodo-4-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 171296503 |
| Molecular Formula | C18H17F3I2N2O2 |
| Molecular Weight | 604.15 g/mol |
| Exact Mass | 603.93 |
| IUPAC Name | 2,6-diiodo-4-[(R)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
| SMILES | Oc1c(I)cc([C@@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)cc1I |
| InChI | InChI=1S/C18H17F3I2N2O2/c19-18(20,21)27-13-3-1-11(2-4-13)16(25-7-5-24-6-8-25)12-9-14(22)17(26)15(23)10-12/h1-4,9-10,16,24,26H,5-8H2/t16-/m1/s1 |
| InChIKey | RDRUXSJTAMWKCH-MRXNPFEDSA-N |
| XLogP | 4.49 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.15 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|