C18H20Cl2F3IN2O — CID 171293335
1-[(R)-(3-iodophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171293335) has the molecular formula C18H20Cl2F3IN2O and a molecular weight of 535.18 g/mol. Its IUPAC name is 1-[(R)-(3-iodophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(3-iodophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171293335 |
| Molecular Formula | C18H20Cl2F3IN2O |
| Molecular Weight | 535.18 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | 1-[(R)-(3-iodophenyl)-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)Oc1ccc([C@H](c2cccc(I)c2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C18H18F3IN2O.2ClH/c19-18(20,21)25-16-6-4-13(5-7-16)17(24-10-8-23-9-11-24)14-2-1-3-15(22)12-14;;/h1-7,12,17,23H,8-11H2;2*1H/t17-;;/m1../s1 |
| InChIKey | FDOPBRKRNQOKNP-ZEECNFPPSA-N |
| XLogP | 5.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.18 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|