C26H35F3N2O2 — CID 171272277
2,6-ditert-butyl-4-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol (PubChem CID 171272277) has the molecular formula C26H35F3N2O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 171272277 |
| Molecular Formula | C26H35F3N2O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(S)-piperazin-1-yl-[4-(trifluoromethoxy)phenyl]methyl]phenol |
| SMILES | CC(C)(C)c1cc([C@H](c2ccc(OC(F)(F)F)cc2)N2CCNCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H35F3N2O2/c1-24(2,3)20-15-18(16-21(23(20)32)25(4,5)6)22(31-13-11-30-12-14-31)17-7-9-19(10-8-17)33-26(27,28)29/h7-10,15-16,22,30,32H,11-14H2,1-6H3/t22-/m0/s1 |
| InChIKey | BMVZFTKMUHHYHK-QFIPXVFZSA-N |
| XLogP | 5.88 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |