C16H17F3N2OS — CID 171177341
1-[(S)-thiophen-3-yl-[3-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171177341) has the molecular formula C16H17F3N2OS and a molecular weight of 342.39 g/mol. Its IUPAC name is 1-[(S)-thiophen-3-yl-[3-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-thiophen-3-yl-[3-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171177341 |
| Molecular Formula | C16H17F3N2OS |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[(S)-thiophen-3-yl-[3-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)Oc1cccc([C@@H](c2ccsc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H17F3N2OS/c17-16(18,19)22-14-3-1-2-12(10-14)15(13-4-9-23-11-13)21-7-5-20-6-8-21/h1-4,9-11,15,20H,5-8H2/t15-/m0/s1 |
| InChIKey | PLINLUCYJJHDFZ-HNNXBMFYSA-N |
| XLogP | 3.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |