C16H18ClF3N2S — CID 171179883
1-[(R)-thiophen-3-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171179883) has the molecular formula C16H18ClF3N2S and a molecular weight of 362.85 g/mol. Its IUPAC name is 1-[(R)-thiophen-3-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-thiophen-3-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171179883 |
| Molecular Formula | C16H18ClF3N2S |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-[(R)-thiophen-3-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc([C@H](c2ccsc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H17F3N2S.ClH/c17-16(18,19)14-3-1-2-12(10-14)15(13-4-9-22-11-13)21-7-5-20-6-8-21;/h1-4,9-11,15,20H,5-8H2;1H/t15-;/m1./s1 |
| InChIKey | JLEGYDBCCVCXAA-XFULWGLBSA-N |
| XLogP | 4.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |