C15H18ClFN2OS — CID 171178362
2-fluoro-4-[(R)-piperazin-1-yl(thiophen-3-yl)methyl]phenol;hydrochloride (PubChem CID 171178362) has the molecular formula C15H18ClFN2OS and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-fluoro-4-[(R)-piperazin-1-yl(thiophen-3-yl)methyl]phenol;hydrochloride.
| Compound Name | 2-fluoro-4-[(R)-piperazin-1-yl(thiophen-3-yl)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171178362 |
| Molecular Formula | C15H18ClFN2OS |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-fluoro-4-[(R)-piperazin-1-yl(thiophen-3-yl)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc([C@H](c2ccsc2)N2CCNCC2)cc1F |
| InChI | InChI=1S/C15H17FN2OS.ClH/c16-13-9-11(1-2-14(13)19)15(12-3-8-20-10-12)18-6-4-17-5-7-18;/h1-3,8-10,15,17,19H,4-7H2;1H/t15-;/m1./s1 |
| InChIKey | LGRBMWAULOIJMD-XFULWGLBSA-N |
| XLogP | 3.01 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |