C16H19FN2S — CID 171175555
1-[(S)-(2-fluoro-4-methylphenyl)-thiophen-3-ylmethyl]piperazine (PubChem CID 171175555) has the molecular formula C16H19FN2S and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[(S)-(2-fluoro-4-methylphenyl)-thiophen-3-ylmethyl]piperazine.
| Compound Name | 1-[(S)-(2-fluoro-4-methylphenyl)-thiophen-3-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171175555 |
| Molecular Formula | C16H19FN2S |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[(S)-(2-fluoro-4-methylphenyl)-thiophen-3-ylmethyl]piperazine |
| SMILES | Cc1ccc([C@@H](c2ccsc2)N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C16H19FN2S/c1-12-2-3-14(15(17)10-12)16(13-4-9-20-11-13)19-7-5-18-6-8-19/h2-4,9-11,16,18H,5-8H2,1H3/t16-/m1/s1 |
| InChIKey | XCKRAIQEXAWYMD-MRXNPFEDSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |