C15H16BrFN2S — CID 171178801
1-[(S)-(2-bromo-4-fluorophenyl)-thiophen-3-ylmethyl]piperazine (PubChem CID 171178801) has the molecular formula C15H16BrFN2S and a molecular weight of 355.28 g/mol. Its IUPAC name is 1-[(S)-(2-bromo-4-fluorophenyl)-thiophen-3-ylmethyl]piperazine.
| Compound Name | 1-[(S)-(2-bromo-4-fluorophenyl)-thiophen-3-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171178801 |
| Molecular Formula | C15H16BrFN2S |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 1-[(S)-(2-bromo-4-fluorophenyl)-thiophen-3-ylmethyl]piperazine |
| SMILES | Fc1ccc([C@H](c2ccsc2)N2CCNCC2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrFN2S/c16-14-9-12(17)1-2-13(14)15(11-3-8-20-10-11)19-6-4-18-5-7-19/h1-3,8-10,15,18H,4-7H2/t15-/m0/s1 |
| InChIKey | FXMNWXGWYYPGBX-HNNXBMFYSA-N |
| XLogP | 3.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |