C15H16F2N2S — CID 171179292
1-[(R)-(2,6-difluorophenyl)-thiophen-3-ylmethyl]piperazine (PubChem CID 171179292) has the molecular formula C15H16F2N2S and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-[(R)-(2,6-difluorophenyl)-thiophen-3-ylmethyl]piperazine.
| Compound Name | 1-[(R)-(2,6-difluorophenyl)-thiophen-3-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171179292 |
| Molecular Formula | C15H16F2N2S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[(R)-(2,6-difluorophenyl)-thiophen-3-ylmethyl]piperazine |
| SMILES | Fc1cccc(F)c1[C@H](c1ccsc1)N1CCNCC1 |
| InChI | InChI=1S/C15H16F2N2S/c16-12-2-1-3-13(17)14(12)15(11-4-9-20-10-11)19-7-5-18-6-8-19/h1-4,9-10,15,18H,5-8H2/t15-/m0/s1 |
| InChIKey | LFCZCMOKGPSOBL-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |